* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 3-BROMO-8-FLUOROQUINOLINE |
| CAS: | 855477-01-9 |
| English Synonyms: | 3-BROMO-8-FLUOROQUINOLINE |
| MDL Number.: | MFCD16658736 |
| H bond acceptor: | 1 |
| H bond donor: | 0 |
| Smile: | c1cc2cc(cnc2c(c1)F)Br |
| InChi: | InChI=1S/C9H5BrFN/c10-7-4-6-2-1-3-8(11)9(6)12-5-7/h1-5H |
| InChiKey: | InChIKey=LSJWECDASRDXEY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.