* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 2,5-DIMETHYL-[1,1-BIPHENYL]-4,4-DIOL |
| CAS: | 855594-79-5 |
| English Synonyms: | [1,1-BIPHENYL]-4,4-DIOL, 2,5-DIMETHYL- ; 2,5-DIMETHYL-[1,1-BIPHENYL]-4,4-DIOL |
| MDL Number.: | MFCD17018027 |
| H bond acceptor: | 2 |
| H bond donor: | 2 |
| Smile: | Cc1cc(c(cc1O)C)c2ccc(cc2)O |
| InChi: | InChI=1S/C14H14O2/c1-9-8-14(16)10(2)7-13(9)11-3-5-12(15)6-4-11/h3-8,15-16H,1-2H3 |
| InChiKey: | InChIKey=KHRWTMAKRAMMSZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.