* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 7-CAMPHENAMINE |
| CAS: | 855625-69-3 |
| English Synonyms: | 7-CAMPHENAMINE |
| MDL Number.: | MFCD17018030 |
| H bond acceptor: | 1 |
| H bond donor: | 1 |
| Smile: | CC1([C@@H]2CC[C@@H](C2N)C1=C)C |
| InChi: | InChI=1S/C10H17N/c1-6-7-4-5-8(9(7)11)10(6,2)3/h7-9H,1,4-5,11H2,2-3H3/t7-,8-,9?/m1/s1 |
| InChiKey: | InChIKey=AZJMAXKADBJHAK-ZAZKALAHSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.