Molecular Structure:
CAS No.:
85577-25-9
Product Name.:
CCD No.:CCD00191919
Formula:C7 H Cl D4 O2
MolWeight:160.592
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(3)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | 4-CHLOROBENZOIC-D4 ACID |
| CAS： | 85577-25-9 |
| English Synonyms： | 4-CHLOROBENZOIC-D4 ACID |
| MDL Number.： | MFCD01074234 |
| H bond acceptor： | 2 |
| H bond donor： | 1 |
| Smile： | [2H]c1c(c(c(c(c1C(=O)O)[2H])[2H])Cl)[2H] |
| InChiKey： | InChIKey=null |
|
|
| Information： | 98 ATOM % D |
|
|
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
