* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | PURIN-8-OL, N-OXIDE |
CAS: | 856611-22-8 |
English Synonyms: | PURIN-8-OL, N-OXIDE |
MDL Number.: | MFCD17018065 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | c1c2c(ncn1)[n+](c([nH]2)O)[O-] |
InChi: | InChI=1S/C5H4N4O2/c10-5-8-3-1-6-2-7-4(3)9(5)11/h1-2,8,10H |
InChiKey: | InChIKey=XKBLKHOIPKTWKP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.