Molecular Structure:
CAS No.:
856786-89-5
Product Name.:
CCD No.:CCD03289117
Formula:C2 H4 N2 O2 S2
MolWeight:152.198
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(1)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | OXAMIDE, DITHIO-, S,S-DIOXIDE |
| CAS： | 856786-89-5 |
| English Synonyms： | OXAMIDE, DITHIO-, S,S-DIOXIDE |
| MDL Number.： | MFCD17018071 |
| H bond acceptor： | 4 |
| H bond donor： | 2 |
| Smile： | C(=S)(C(=S(=O)=O)N)N |
| InChi： | InChI=1S/C2H4N2O2S2/c3-1(7)2(4)8(5)6/h4H2,(H2,3,7) |
| InChiKey： | InChIKey=YSVYCWIMBXQDBG-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
