Molecular Structure:
CAS No.:
857035-94-0
Product Name.:
CCD No.:CCD03258207
Formula:C6 H10 N4 O
MolWeight:154.172
![1H,5H-PYRAZOLO[1,2-A]PYRAZOL-1-ONE, 2,3-DIAMINO-6,7-DIHYDRO- Detailed](../images/deli.png)
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(1)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | 1H,5H-PYRAZOLO[1,2-A]PYRAZOL-1-ONE, 2,3-DIAMINO-6,7-DIHYDRO- |
| CAS： | 857035-94-0 |
| English Synonyms： | 1H,5H-PYRAZOLO[1,2-A]PYRAZOL-1-ONE, 2,3-DIAMINO-6,7-DIHYDRO- ; 2,3-DIAMINO-6,7-DIHYDRO-1H,5H-PYRAZOLO[1,2-A]PYRAZOL-1-ONE |
| MDL Number.： | MFCD16878211 |
| H bond acceptor： | 5 |
| H bond donor： | 2 |
| Smile： | C1Cn2c(c(c(=O)n2C1)N)N |
| InChi： | InChI=1S/C6H10N4O/c7-4-5(8)9-2-1-3-10(9)6(4)11/h1-3,7-8H2 |
| InChiKey： | InChIKey=ZLOJSTQJEWRDGU-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
