Molecular Structure:
CAS No.:
859304-28-2
Product Name.:
CCD No.:CCD03258354
Formula:C13 H9 N O5
MolWeight:259.216
![7-METHOXY-9-METHYL-FURO[2,3-B]QUINOLINE-4,5,8(9H)-TRIONE Detailed](../images/deli.png)
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | 7-METHOXY-9-METHYL-FURO[2,3-B]QUINOLINE-4,5,8(9H)-TRIONE |
| CAS： | 859304-28-2 |
| English Synonyms： | 7-METHOXY-9-METHYL-FURO[2,3-B]QUINOLINE-4,5,8(9H)-TRIONE ; FURO[2,3-B]QUINOLINE-4,5,8(9H)-TRIONE, 7-METHOXY-9-METHYL- |
| MDL Number.： | MFCD16878364 |
| H bond acceptor： | 6 |
| H bond donor： | 0 |
| Smile： | Cn1c2c(c(=O)c3c1occ3)C(=O)C=C(C2=O)OC |
| InChi： | InChI=1S/C13H9NO5/c1-14-10-9(7(15)5-8(18-2)12(10)17)11(16)6-3-4-19-13(6)14/h3-5H,1-2H3 |
| InChiKey： | InChIKey=NTSLTWQRDNWPIG-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
