* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | H-D-TYR-VAL-GLY-OH |
CAS: | 86030-52-6 |
English Synonyms: | D-TYR-VAL-GLY ; DY-V-G ; D-TYR-VAL-GLY-OH ; H-D-TYR-VAL-GLY-OH |
MDL Number.: | MFCD00063349 |
H bond acceptor: | 8 |
H bond donor: | 5 |
Smile: | CC(C)[C@@H](C(=O)NCC(=O)O)NC(=O)[C@@H](Cc1ccc(cc1)O)N |
InChi: | InChI=1S/C16H23N3O5/c1-9(2)14(16(24)18-8-13(21)22)19-15(23)12(17)7-10-3-5-11(20)6-4-10/h3-6,9,12,14,20H,7-8,17H2,1-2H3,(H,18,24)(H,19,23)(H,21,22)/t12-,14+/m1/s1 |
InChiKey: | InChIKey=NWEGIYMHTZXVBP-OCCSQVGLSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.