* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1,2,5-TRIAZOLE, 1-BENZOYL- |
CAS: | 860573-38-2 |
English Synonyms: | 1,2,5-TRIAZOLE, 1-BENZOYL- ; 1-BENZOYL-1,2,5-TRIAZOLE |
MDL Number.: | MFCD16878421 |
H bond acceptor: | 4 |
H bond donor: | 0 |
Smile: | c1ccc(cc1)C(=O)n2nccn2 |
InChi: | InChI=1S/C9H7N3O/c13-9(12-10-6-7-11-12)8-4-2-1-3-5-8/h1-7H |
InChiKey: | InChIKey=NNGXBITUADYBKA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.