* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | Benzene, 2-(4-bromobutyl)-1,4-dichloro- |
CAS: | 860687-71-4 |
English Synonyms: | BENZENE, 2-(4-BROMOBUTYL)-1,4-DICHLORO- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | BrCCCCC1=C(C=CC(=C1)Cl)Cl |
InChi: | InChI=1S/C10H11BrCl2/c11-6-2-1-3-8-7-9(12)4-5-10(8)13/h4-5,7H,1-3,6H2 |
InChiKey: | InChIKey=IEDJHJZTNCUMLE-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.