* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 5-CHLORO-2,3-DIMETHYLQUINOLIN-4-OL |
| CAS: | 860714-99-4 |
| English Synonyms: | 5-CHLORO-2,3-DIMETHYLQUINOLIN-4-OL |
| MDL Number.: | MFCD12828496 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | Cc1c(nc2cccc(c2c1O)Cl)C |
| InChi: | InChI=1S/C11H10ClNO/c1-6-7(2)13-9-5-3-4-8(12)10(9)11(6)14/h3-5H,1-2H3,(H,13,14) |
| InChiKey: | InChIKey=BMGUGNMJBDVOLG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.