* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 1-(4-METHYL-PHENYL)-2-BUTANAMINE HCL |
| CAS: | 861007-56-9 |
| English Synonyms: | 1-(4-METHYL-PHENYL)-2-BUTANAMINE HCL |
| MDL Number.: | MFCD08450672 |
| H bond acceptor: | 1 |
| H bond donor: | 1 |
| Smile: | CCC(Cc1ccc(cc1)C)N.Cl |
| InChi: | InChI=1S/C11H17N.ClH/c1-3-11(12)8-10-6-4-9(2)5-7-10;/h4-7,11H,3,8,12H2,1-2H3;1H |
| InChiKey: | InChIKey=YUGKCOKMRMUXPZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.