* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 4-BROMO-3,5-DIIODOBENZOIC ACID |
CAS: | 861117-99-9 |
English Synonyms: | 4-BROMO-3,5-DIIODOBENZOIC ACID |
MDL Number.: | MFCD11109503 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | c1c(cc(c(c1I)Br)I)C(=O)O |
InChi: | InChI=1S/C7H3BrI2O2/c8-6-4(9)1-3(7(11)12)2-5(6)10/h1-2H,(H,11,12) |
InChiKey: | InChIKey=GYACLFCYRGVTOB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.