* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | BORONIC ACID, B,B'-(9,9-DIMETHYL-9H-XANTHENE-4,5-DIYL)BIS- |
| CAS: | 862159-27-1 |
| EnglishSynonyms: | BORONIC ACID, B,B'-(9,9-DIMETHYL-9H-XANTHENE-4,5-DIYL)BIS- |
| pro_mdlNumber: | MFCD12196935 |
| pro_acceptors: | 5 |
| pro_donors: | 4 |
| pro_smile: | B(c1cccc2c1Oc3c(cccc3C2(C)C)B(O)O)(O)O |
| InChi: | InChI=1S/C15H16B2O5/c1-15(2)9-5-3-7-11(16(18)19)13(9)22-14-10(15)6-4-8-12(14)17(20)21/h3-8,18-21H,1-2H3 |
| InChiKey: | InChIKey=BXWZPWDOAASIEC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.