Molecular Structure:
CAS No.:
862191-49-9
Product Name.:
CCD No.:CCD03289343
Formula:C8 H6 Cl N O2
MolWeight:183.593
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(1)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | 1,4,3-BENZOXAZ-3-ONE, 6-CHLORO-7-METHYL- |
| CAS： | 862191-49-9 |
| English Synonyms： | 6-CHLORO-7-METHYL-2H,3H-FURO[3,2-B]PYRIDIN-3-ONE ; 1,4,3-BENZOXAZ-3-ONE, 6-CHLORO-7-METHYL- ; 6-CHLORO-7-METHYL-1,4,3-BENZOXAZ-3-ONE |
| MDL Number.： | MFCD17018297 |
| H bond acceptor： | 3 |
| H bond donor： | 0 |
| Smile： | Cc1c(cnc2c1OCC2=O)Cl |
| InChi： | InChI=1S/C8H6ClNO2/c1-4-5(9)2-10-7-6(11)3-12-8(4)7/h2H,3H2,1H3 |
| InChiKey： | InChIKey=VIIXQCNOLHPINR-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
