Molecular Structure:
CAS No.:
862374-91-2
Product Name.:
CCD No.:CCD03258497
Formula:C8 H10 O4
MolWeight:170.163
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(1)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | 1,4-DIOXANE-2,5-DIONE, 3-METHYL-6-(2-PROPENYL)- |
| CAS： | 862374-91-2 |
| English Synonyms： | 3-METHYL-6-(PROP-2-EN-1-YL)-1,4-DIOXANE-2,5-DIONE ; 1,4-DIOXANE-2,5-DIONE, 3-METHYL-6-(2-PROPENYL)- ; 3-METHYL-6-(2-PROPENYL)-1,4-DIOXANE-2,5-DIONE |
| MDL Number.： | MFCD16878514 |
| H bond acceptor： | 4 |
| H bond donor： | 0 |
| Smile： | CC1C(=O)OC(C(=O)O1)CC=C |
| InChi： | InChI=1S/C8H10O4/c1-3-4-6-8(10)11-5(2)7(9)12-6/h3,5-6H,1,4H2,2H3 |
| InChiKey： | InChIKey=MEJWTGVMNYEBMC-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
