* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 4-Piperidinol, 4-(3,5-difluorophenyl)- |
CAS: | 863111-07-3 |
English Synonyms: | 4-PIPERIDINOL, 4-(3,5-DIFLUOROPHENYL)- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | FC=1C=C(C=C(C1)F)C1(CCNCC1)O |
InChi: | InChI=1S/C11H13F2NO/c12-9-5-8(6-10(13)7-9)11(15)1-3-14-4-2-11/h5-7,14-15H,1-4H2 |
InChiKey: | InChIKey=VRSMNZBICYMDLY-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.