* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 2-CHLORO-5-(1,3-DIOXAN-2-YL)-QUINOLINE |
| CAS: | 863549-10-4 |
| English Synonyms: | 2-CHLORO-5-(1,3-DIOXAN-2-YL)-QUINOLINE ; QUINOLINE, 2-CHLORO-5-(1,3-DIOXAN-2-YL)- |
| MDL Number.: | MFCD16878538 |
| H bond acceptor: | 3 |
| H bond donor: | 0 |
| Smile: | c1cc(c2ccc(nc2c1)Cl)C3OCCCO3 |
| InChi: | InChI=1S/C13H12ClNO2/c14-12-6-5-9-10(3-1-4-11(9)15-12)13-16-7-2-8-17-13/h1,3-6,13H,2,7-8H2 |
| InChiKey: | InChIKey=BUZDHEASUAQYTJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.