Molecular Structure:
CAS No.:
863554-80-7
Product Name.:
CCD No.:CCD03289359
Formula:C8 H13 N O2
MolWeight:155.196
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(1)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | 2-MORPHOLINONE, 5-(2E)-2-BUTENYL- |
| CAS： | 863554-80-7 |
| English Synonyms： | 5-[(2E)-BUT-2-EN-1-YL]MORPHOLIN-2-ONE ; 5-(2E)-2-BUTENYL-2-MORPHOLINONE ; 2-MORPHOLINONE, 5-(2E)-2-BUTENYL- |
| MDL Number.： | MFCD17018313 |
| H bond acceptor： | 3 |
| H bond donor： | 1 |
| Smile： | C/C=C/CC1COC(=O)CN1 |
| InChi： | InChI=1S/C8H13NO2/c1-2-3-4-7-6-11-8(10)5-9-7/h2-3,7,9H,4-6H2,1H3/b3-2+ |
| InChiKey： | InChIKey=WXMLLIQBAIOTJG-NSCUHMNNSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
