* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | (7R,9R)-7,9-METHANO-3,8,8-TRIMETHYL-4A,5,8,9-TETRAHYDRO-1H,7H-PYRANO[4,3-B]BENZOPYRAN-1-ONE |
| CAS: | 863566-91-0 |
| English Synonyms: | (7R,9R)-7,9-METHANO-3,8,8-TRIMETHYL-4A,5,8,9-TETRAHYDRO-1H,7H-PYRANO[4,3-B]BENZOPYRAN-1-ONE |
| MDL Number.: | MFCD08752427 |
| H bond acceptor: | 3 |
| H bond donor: | 0 |
| Smile: | Cc1cc2c(c(=O)o1)C=C3[C@@H]4C[C@@H](C4(C)C)C[C@H]3O2 |
| InChi: | InChI=1S/C16H18O3/c1-8-4-13-11(15(17)18-8)7-10-12-5-9(16(12,2)3)6-14(10)19-13/h4,7,9,12,14H,5-6H2,1-3H3/t9-,12+,14-/m1/s1 |
| InChiKey: | InChIKey=YTSAKKVFBOGNHK-LJWDBELGSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.