* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 7H-FURO[3,2-F]INDOLE |
| CAS: | 863993-85-5 |
| English Synonyms: | 7H-FURO[3,2-F]INDOLE |
| MDL Number.: | MFCD16878551 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | c1c[nH]c2c1cc3ccoc3c2 |
| InChi: | InChI=1S/C10H7NO/c1-3-11-9-6-10-8(2-4-12-10)5-7(1)9/h1-6,11H |
| InChiKey: | InChIKey=WCHDQSFJCXWNCQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.