* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 4-(1H-INDOL-4-YL)BENZYL ALCOHOL |
CAS: | 864871-35-2 |
English Synonyms: | 4-(1H-INDOL-4-YL)BENZYL ALCOHOL |
MDL Number.: | MFCD16878572 |
H bond acceptor: | 2 |
H bond donor: | 2 |
Smile: | c1cc(c2cc[nH]c2c1)c3ccc(cc3)CO |
InChi: | InChI=1S/C15H13NO/c17-10-11-4-6-12(7-5-11)13-2-1-3-15-14(13)8-9-16-15/h1-9,16-17H,10H2 |
InChiKey: | InChIKey=TZOSCFQPRIKQIA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.