* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | CX-3543 |
| CAS: | 865311-47-3 |
| English Synonyms: | QUARFLOXACIN ; CX-3543 ; QUARFLOXIN |
| MDL Number.: | MFCD17215197 |
| H bond acceptor: | 9 |
| H bond donor: | 1 |
| Smile: | CN1CCC[C@H]1CCNC(=O)c2cn-3c4c(c2=O)cc(c(c4Oc5c3cc6ccccc6c5)N7CCC(C7)c8cnccn8)F |
| InChi: | InChI=1S/C35H33FN6O3/c1-40-13-4-7-24(40)8-10-39-35(44)26-20-42-29-15-21-5-2-3-6-22(21)16-30(29)45-34-31(42)25(33(26)43)17-27(36)32(34)41-14-9-23(19-41)28-18-37-11-12-38-28/h2-3,5-6,11-12,15-18,20,23-24H,4,7-10,13-14,19H2,1H3,(H,39,44)/t23?,24-/m0/s1 |
| InChiKey: | InChIKey=WOQIDNWTQOYDLF-CGAIIQECSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.