* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 5-((6-(1,4-THIAZINAN-4-YL)-3-PYRIDINYL)METHYLENE)-2,4,6(1H,3H,5H)-PYRIMIDINETRIONE |
CAS: | 866020-06-6 |
English Synonyms: | 5-((6-(1,4-THIAZINAN-4-YL)-3-PYRIDINYL)METHYLENE)-2,4,6(1H,3H,5H)-PYRIMIDINETRIONE |
MDL Number.: | MFCD04125527 |
H bond acceptor: | 7 |
H bond donor: | 2 |
Smile: | c1cc(ncc1C=C2C(=O)NC(=O)NC2=O)N3CCSCC3 |
InChi: | InChI=1S/C14H14N4O3S/c19-12-10(13(20)17-14(21)16-12)7-9-1-2-11(15-8-9)18-3-5-22-6-4-18/h1-2,7-8H,3-6H2,(H2,16,17,19,20,21) |
InChiKey: | InChIKey=MOPGREDCDPPKGU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.