* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 5-BUTYL-4-(4-METHYLBENZYL)-2,4-DIHYDRO-3H-1,2,4-TRIAZOLE-3-THIONE |
CAS: | 866152-84-3 |
English Synonyms: | 5-BUTYL-4-(4-METHYLBENZYL)-2,4-DIHYDRO-3H-1,2,4-TRIAZOLE-3-THIONE |
MDL Number.: | MFCD05669401 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CCCCc1n[nH]c(=S)n1Cc2ccc(cc2)C |
InChi: | InChI=1S/C14H19N3S/c1-3-4-5-13-15-16-14(18)17(13)10-12-8-6-11(2)7-9-12/h6-9H,3-5,10H2,1-2H3,(H,16,18) |
InChiKey: | InChIKey=GPLHSHCRBSOULM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.