* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 4,5-DIHYDRO-9H-PURIN-6-AMINE |
CAS: | 866231-41-6 |
English Synonyms: | 9H-PURIN-6-AMINE, 4,5-DIHYDRO- ; 4,5-DIHYDRO-9H-PURIN-6-AMINE |
MDL Number.: | MFCD16878595 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | C1=NC2C(N1)N=CN=C2N |
InChi: | InChI=1S/C5H7N5/c6-4-3-5(9-1-7-3)10-2-8-4/h1-3,5H,(H,7,9)(H2,6,8,10) |
InChiKey: | InChIKey=ANCXJRQOLALVNI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.