* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9-METHYL-9H-CARBAZOLE-3,4,5,6-TETRAMINE |
CAS: | 866360-37-4 |
English Synonyms: | 9H-CARBAZOLE-3,4,5,6-TETRAMINE, 9-METHYL- ; 9-METHYL-9H-CARBAZOLE-3,4,5,6-TETRAMINE |
MDL Number.: | MFCD16878603 |
H bond acceptor: | 5 |
H bond donor: | 4 |
Smile: | Cn1c2ccc(c(c2c3c1ccc(c3N)N)N)N |
InChi: | InChI=1S/C13H15N5/c1-18-8-4-2-6(14)12(16)10(8)11-9(18)5-3-7(15)13(11)17/h2-5H,14-17H2,1H3 |
InChiKey: | InChIKey=GPBIFTHFSNQBRX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.