* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 3,9-DIAZASPIRO[5.5]UNDECAN-2-ONE |
| CAS: | 867006-20-0 |
| English Synonyms: | 3,9-DIAZASPIRO[5.5]UNDECAN-2-ONE |
| MDL Number.: | MFCD13179151 |
| H bond acceptor: | 3 |
| H bond donor: | 2 |
| Smile: | C1CNCCC12CCNC(=O)C2 |
| InChi: | InChI=1S/C9H16N2O/c12-8-7-9(3-6-11-8)1-4-10-5-2-9/h10H,1-7H2,(H,11,12) |
| InChiKey: | InChIKey=IAXNSRPALMNQBY-UHFFFAOYSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.