* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-(5-PIPERIDIN-4-YL-4H-1,2,4-TRIAZOL-3-YL)-PYRIDINE |
CAS: | 868280-68-6 |
English Synonyms: | 2-(5-PIPERIDIN-4-YL-4H-1,2,4-TRIAZOL-3-YL)-PYRIDINE ; 3-(4-PIPERIDYL)-5-(2-PYRIDYL)-4H-1,2,4-TRIAZOLE ; ABBYPHARMA AP-31-3233 |
MDL Number.: | MFCD06654881 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | c1ccnc(c1)c2[nH]c(nn2)C3CCNCC3 |
InChi: | InChI=1S/C12H15N5/c1-2-6-14-10(3-1)12-15-11(16-17-12)9-4-7-13-8-5-9/h1-3,6,9,13H,4-5,7-8H2,(H,15,16,17) |
InChiKey: | InChIKey=QITDVUFBATVFRV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.