* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | N-Boc-O-(3-Boc-aminopropyl)-L-tyrosine |
CAS: | 86937-03-3 |
English Synonyms: | N-BOC-O-(3-BOC-AMINOPROPYL)-L-TYROSINE |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | C(=O)(OC(C)(C)C)N[C@@H](CC1=CC=C(C=C1)OCCC(C(=O)OC(C)(C)C)N)C(=O)O |
InChi: | InChI=1S/C22H34N2O7/c1-21(2,3)30-19(27)16(23)11-12-29-15-9-7-14(8-10-15)13-17(18(25)26)24-20(28)31-22(4,5)6/h7-10,16-17H,11-13,23H2,1-6H3,(H,24,28)(H,25,26)/t16?,17-/m0/s1 |
InChiKey: | InChIKey=VGWHMKRFCALFKN-DJNXLDHESA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.