* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | ALMECILLIN |
CAS: | 87-09-2 |
English Synonyms: | ALMECILLIN |
MDL Number.: | MFCD00865077 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | CC1([C@@H](N2[C@H](S1)[C@@H](C2=O)NC(=O)CSCC=C)C(=O)O)C |
InChi: | InChI=1S/C13H18N2O4S2/c1-4-5-20-6-7(16)14-8-10(17)15-9(12(18)19)13(2,3)21-11(8)15/h4,8-9,11H,1,5-6H2,2-3H3,(H,14,16)(H,18,19)/t8-,9+,11-/m1/s1 |
InChiKey: | InChIKey=QULKGELYPOJSLP-WCABBAIRSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.