* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2,5-DIBROMO-4-(DECYLOXY)PHENOL |
CAS: | 870703-49-4 |
English Synonyms: | 2,5-DIBROMO-4-(DECYLOXY)PHENOL |
MDL Number.: | MFCD05664374 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | CCCCCCCCCCOc1cc(c(cc1Br)O)Br |
InChi: | InChI=1S/C16H24Br2O2/c1-2-3-4-5-6-7-8-9-10-20-16-12-13(17)15(19)11-14(16)18/h11-12,19H,2-10H2,1H3 |
InChiKey: | InChIKey=SSEJKDGLNTZULX-UHFFFAOYSA-N |
Property |
|
Melting Point: | 62-66 DEG C(LIT) |
Comments: | UNSPSC: 12162002 WGK: 3 |
Safety information |
|
Symbol: | GHS07 |
Signal word: | Warning |
Hazard statements: | H315-H319-H335 |
Precautionary statements: | P261-P305 + P351 + P338 |
hazard symbol: | Xi |
Risk Code: | R:36/37/38 |
Safe Code: | S:26-36 |
WGK Germany: | 3 |
* If the product has intellectual property rights, a license granted is must or contact us.