* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-AMINO-1-(1H-INDOL-3-YL)ETHANONE |
CAS: | 87084-40-0 |
English Synonyms: | 2-AMINO-1-(1H-INDOL-3-YL)ETHAN-1-ONE ; 2-AMINO-1-(1H-INDOL-3-YL)ETHANONE |
MDL Number.: | MFCD03425074 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | c1ccc2c(c1)c(c[nH]2)C(=O)CN |
InChi: | InChI=1S/C10H10N2O/c11-5-10(13)8-6-12-9-4-2-1-3-7(8)9/h1-4,6,12H,5,11H2 |
InChiKey: | InChIKey=RBEUYOPWLNUISU-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.