* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-Propanone, 1-(2-iodophenoxy)- |
CAS: | 871565-59-2 |
English Synonyms: | 2-PROPANONE, 1-(2-IODOPHENOXY)- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | IC1=C(OCC(C)=O)C=CC=C1 |
InChi: | InChI=1S/C9H9IO2/c1-7(11)6-12-9-5-3-2-4-8(9)10/h2-5H,6H2,1H3 |
InChiKey: | InChIKey=NWNILAWUMDBBFW-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.