* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 1,3-DIHYDRO-6,8-DIMETHYL-2H-PURIN-2-ONE |
| CAS: | 871902-86-2 |
| English Synonyms: | 1,3-DIHYDRO-6,8-DIMETHYL-2H-PURIN-2-ONE ; 2H-PURIN-2-ONE, 1,3-DIHYDRO-6,8-DIMETHYL- ; 6,8-DIMETHYL-2,3-DIHYDRO-1H-PURIN-2-ONE |
| MDL Number.: | MFCD16878688 |
| H bond acceptor: | 5 |
| H bond donor: | 2 |
| Smile: | Cc1c-2nc(nc2[nH]c(=O)[nH]1)C |
| InChi: | InChI=1S/C7H8N4O/c1-3-5-6(10-4(2)9-5)11-7(12)8-3/h1-2H3,(H2,8,9,10,11,12) |
| InChiKey: | InChIKey=RSFAWEORRXJPGQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.