* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-BUTEN-1-ONE, 2-METHYL-1-(3-METHYL-2-OXIRANYL)- |
CAS: | 872308-04-8 |
English Synonyms: | 2-METHYL-1-(3-METHYL-2-OXIRANYL)-2-BUTEN-1-ONE ; 2-BUTEN-1-ONE, 2-METHYL-1-(3-METHYL-2-OXIRANYL)- |
MDL Number.: | MFCD16878714 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | C/C=C(\C)/C(=O)C1C(O1)C |
InChi: | InChI=1S/C8H12O2/c1-4-5(2)7(9)8-6(3)10-8/h4,6,8H,1-3H3/b5-4+ |
InChiKey: | InChIKey=AJVDBWWWRPLGJV-SNAWJCMRSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.