* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1,2,4,5-DIEPOXY-3-HEXANONE |
CAS: | 872310-29-7 |
English Synonyms: | 3-HEXANONE, 1,2,4,5-DIEPOXY- ; 1,2,4,5-DIEPOXY-3-HEXANONE ; 2-METHYL-3-[(OXIRAN-2-YL)CARBONYL]OXIRANE |
MDL Number.: | MFCD16878716 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | CC1C(O1)C(=O)C2CO2 |
InChi: | InChI=1S/C6H8O3/c1-3-6(9-3)5(7)4-2-8-4/h3-4,6H,2H2,1H3 |
InChiKey: | InChIKey=BMLMKQFZLUEHER-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.