* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1,4-DIOXANE-2,5-DIONE, 3,6-DI-3-BUTENYL- |
CAS: | 872413-52-0 |
English Synonyms: | 3,6-DI-3-BUTENYL-1,4-DIOXANE-2,5-DIONE ; 1,4-DIOXANE-2,5-DIONE, 3,6-DI-3-BUTENYL- |
MDL Number.: | MFCD17018402 |
H bond acceptor: | 4 |
H bond donor: | 0 |
Smile: | C=CCCC1C(=O)OC(C(=O)O1)CCC=C |
InChi: | InChI=1S/C12H16O4/c1-3-5-7-9-11(13)16-10(8-6-4-2)12(14)15-9/h3-4,9-10H,1-2,5-8H2 |
InChiKey: | InChIKey=QDNGPKDNWWZJKE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.