* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 3-[1,2,4]TRIAZOLO[3,4-B][1,3,4]THIADIAZOL-6-YL-PHENYLAMINE |
CAS: | 872495-89-1 |
English Synonyms: | ZERENEX E/9070827 ; BENZENAMINE, 3-[1,2,4]TRIAZOLO[3,4-B][1,3,4]THIADIAZOL-6-YL- ; 3-[1,2,4]TRIAZOLO[3,4-B][1,3,4]THIADIAZOL-6-YL-PHENYLAMINE ; 3-([1,2,4]TRIAZOLO[3,4-B][1,3,4]THIADIAZOL-6-YL)ANILINE |
MDL Number.: | MFCD05668065 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | c1cc(cc(c1)N)c2nn3cnnc3s2 |
InChi: | InChI=1S/C9H7N5S/c10-7-3-1-2-6(4-7)8-13-14-5-11-12-9(14)15-8/h1-5H,10H2 |
InChiKey: | InChIKey=ACRZMZLGYMTIHK-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.