* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | (S)-2-(Boc-amino)-4-methyl-4-pentenoic acid |
CAS: | 87325-47-1 |
English Synonyms: | (S)-2-(BOC-AMINO)-4-METHYL-4-PENTENOIC ACID |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | C(=O)(OC(C)(C)C)N[C@H](C(=O)O)CC(=C)C |
InChi: | InChI=1S/C11H19NO4/c1-7(2)6-8(9(13)14)12-10(15)16-11(3,4)5/h8H,1,6H2,2-5H3,(H,12,15)(H,13,14)/t8-/m0/s1 |
InChiKey: | InChIKey=YHWOMLAFEJVSSA-QMMMGPOBSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.