* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | Butanoic acid, 4-(4-ethylphenoxy)- |
CAS: | 87411-26-5 |
English Synonyms: | BUTANOIC ACID, 4-(4-ETHYLPHENOXY)- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | C(C)C1=CC=C(OCCCC(=O)O)C=C1 |
InChi: | InChI=1S/C12H16O3/c1-2-10-5-7-11(8-6-10)15-9-3-4-12(13)14/h5-8H,2-4,9H2,1H3,(H,13,14) |
InChiKey: | InChIKey=ORUNWRBEMLXXLJ-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.