* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 3,4-BENZO-CIS-6-AZABICYCLO[3.2.0]HEPTANE-7-ONE |
CAS: | 874292-63-4 |
English Synonyms: | 3,4-BENZO-CIS-6-AZABICYCLO[3.2.0]HEPTANE-7-ONE |
MDL Number.: | MFCD05863565 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | c1ccc2c(c1)C[C@@H]3[C@H]2NC3=O |
InChi: | InChI=1S/C10H9NO/c12-10-8-5-6-3-1-2-4-7(6)9(8)11-10/h1-4,8-9H,5H2,(H,11,12)/t8-,9+/m1/s1 |
InChiKey: | InChIKey=QBIQMVZCIAHVGB-BDAKNGLRSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.