* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITERALONE |
| CAS: | 87440-75-3 |
| English Synonyms: | VITERALONE |
| MDL Number.: | MFCD20274797 |
| H bond acceptor: | 3 |
| H bond donor: | 0 |
| Smile: | Cc1c2c(cc3c1[C@H](CCC3=O)C)occ2C=O |
| InChi: | InChI=1S/C15H14O3/c1-8-3-4-12(17)11-5-13-15(9(2)14(8)11)10(6-16)7-18-13/h5-8H,3-4H2,1-2H3/t8-/m0/s1 |
| InChiKey: | InChIKey=CTWSYQBTROEFSB-QMMMGPOBSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.