* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1H-PURINE-2,6-DIONE, 3-AMINO-3,9-DIHYDRO- |
CAS: | 875222-16-5 |
English Synonyms: | 3-AMINO-3,9-DIHYDRO-1H-PURINE-2,6-DIONE ; 1H-PURINE-2,6-DIONE, 3-AMINO-3,9-DIHYDRO- |
MDL Number.: | MFCD16878825 |
H bond acceptor: | 7 |
H bond donor: | 3 |
Smile: | c1[nH]c2c(n1)c(=O)[nH]c(=O)n2N |
InChi: | InChI=1S/C5H5N5O2/c6-10-3-2(7-1-8-3)4(11)9-5(10)12/h1H,6H2,(H,7,8)(H,9,11,12) |
InChiKey: | InChIKey=HDVQGRMHFYSLKL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.