* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | DRF 2519 |
CAS: | 875326-27-5 |
English Synonyms: | DRF 2519 ; 5-[[4-[2-(4-OXO-2H-1,3-BENZOXAZIN3(4H)-YL)ETHOXY]PHENYL]METHYL]-2,4-THIAZOLIDINEDIONE |
MDL Number.: | MFCD06798336 |
H bond acceptor: | 7 |
H bond donor: | 1 |
Smile: | c1ccc2c(c1)C(=O)N(CO2)CCOc3ccc(cc3)CC4C(=O)NC(=O)S4 |
InChi: | InChI=1S/C20H18N2O5S/c23-18-17(28-20(25)21-18)11-13-5-7-14(8-6-13)26-10-9-22-12-27-16-4-2-1-3-15(16)19(22)24/h1-8,17H,9-12H2,(H,21,23,25) |
InChiKey: | InChIKey=RFMNEXVCPAPDRA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.