* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | KELAMPAYOSIDE A |
| CAS: | 87562-76-3 |
| English Synonyms: | KELAMPAYOSIDE A |
| MDL Number.: | MFCD20260800 |
| H bond acceptor: | 13 |
| H bond donor: | 6 |
| Smile: | COc1cc(cc(c1OC)OC)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO[C@H]3[C@@H]([C@](CO3)(CO)O)O)O)O)O |
| InChi: | InChI=1S/C20H30O13/c1-27-10-4-9(5-11(28-2)16(10)29-3)32-18-15(24)14(23)13(22)12(33-18)6-30-19-17(25)20(26,7-21)8-31-19/h4-5,12-15,17-19,21-26H,6-8H2,1-3H3/t12-,13-,14+,15-,17+,18-,19-,20-/m1/s1 |
| InChiKey: | InChIKey=CKGKQISENBKOCA-FHXQZXMCSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.