* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 6-OXABICYCLO[3.1.0]HEXAN-2-OL, CARBONATE |
| CAS: | 875830-74-3 |
| English Synonyms: | 6-OXABICYCLO[3.1.0]HEXAN-2-OL, CARBONATE |
| MDL Number.: | MFCD17015327 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | C(O)(O)=O.C12C(CCC2O1)O |
| InChi: | InChI=1S/C5H8O2.CH2O3/c6-3-1-2-4-5(3)7-4;2-1(3)4/h3-6H,1-2H2;(H2,2,3,4) |
| InChiKey: | InChIKey=XFGNHCGRXMJMLE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.