Molecular Structure:
CAS No.:
876310-29-1
Product Name.:
CCD No.:CCD00710259
Formula:C12 Br9 F O
MolWeight:898.265
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(3)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | 4'-FLUORO-2,2',3,3',4,5,5',6,6'-NONABROMODIPHENYL ETHER |
| CAS： | 876310-29-1 |
| English Synonyms： | F-PBDE-208 ; 4'-FLUORO-2,2',3,3',4,5,5',6,6'-NONABROMODIPHENYL ETHER |
| MDL Number.： | MFCD09037628 |
| H bond acceptor： | 1 |
| H bond donor： | 0 |
| Smile： | c1(c(c(c(c(c1Br)Br)F)Br)Br)Oc2c(c(c(c(c2Br)Br)Br)Br)Br |
| InChi： | InChI=1S/C12Br9FO/c13-1-2(14)6(18)11(7(19)3(1)15)23-12-8(20)4(16)10(22)5(17)9(12)21 |
| InChiKey： | InChIKey=FFXSYPMOWPFIOA-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
