* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1-METHOXY-1H-PYRAZOLO[1,5-B][1,2,4]TRIAZOL-7-AMINE |
CAS: | 877321-99-8 |
English Synonyms: | 1-METHOXY-1H-PYRAZOLO[1,5-B][1,2,4]TRIAZOL-7-AMINE ; 1H-PYRAZOLO[1,5-B][1,2,4]TRIAZOL-7-AMINE, 1-METHOXY- |
MDL Number.: | MFCD16878885 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | COn1cnn2c1c(cn2)N |
InChi: | InChI=1S/C5H7N5O/c1-11-9-3-8-10-5(9)4(6)2-7-10/h2-3H,6H2,1H3 |
InChiKey: | InChIKey=MPUJNBIUCLYTTK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.